C21H20N4O4S2 — CID 22567262
N-[3-(3-amino-4-methylphenyl)-1H-indazol-5-yl]-2-methylsulfonylbenzenesulfonamide (PubChem CID 22567262) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[3-(3-amino-4-methylphenyl)-1H-indazol-5-yl]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[3-(3-amino-4-methylphenyl)-1H-indazol-5-yl]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 22567262 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[3-(3-amino-4-methylphenyl)-1H-indazol-5-yl]-2-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2n[nH]c3ccc(NS(=O)(=O)c4ccccc4S(C)(=O)=O)cc23)cc1N |
| InChI | InChI=1S/C21H20N4O4S2/c1-13-7-8-14(11-17(13)22)21-16-12-15(9-10-18(16)23-24-21)25-31(28,29)20-6-4-3-5-19(20)30(2,26)27/h3-12,25H,22H2,1-2H3,(H,23,24) |
| InChIKey | JBINBXKUSLUOMD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|