About (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate
(3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate (PubChem CID 22567352) has the molecular formula C14H10FN3O4S
and a molecular weight of 335.32 g/mol. Its IUPAC name is (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate.
Molecular Properties
| Compound Name | (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate |
| PubChem CID | 22567352 |
| Molecular Formula | C14H10FN3O4S |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate |
| SMILES | NC(=O)c1n[nH]c2ccc(S(=O)(=O)Oc3cccc(F)c3)cc12 |
| InChI | InChI=1S/C14H10FN3O4S/c15-8-2-1-3-9(6-8)22-23(20,21)10-4-5-12-11(7-10)13(14(16)19)18-17-12/h1-7H,(H2,16,19)(H,17,18) |
| InChIKey | TWDABOOPSLXMLX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate?
The IUPAC name of (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate (CID 22567352) is (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate.
What is the SMILES notation for (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate?
The canonical SMILES for (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate is NC(=O)c1n[nH]c2ccc(S(=O)(=O)Oc3cccc(F)c3)cc12.
What is the InChIKey of (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate?
The InChIKey is TWDABOOPSLXMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O4S/c15-8-2-1-3-9(6-8)22-23(20,21)10-4-5-12-11(7-10)13(14(16)19)18-17-12/h1-7H,(H2,16,19)(H,17,18).
What are the key properties of (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate?
(3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate has a molecular weight of 335.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) 3-carbamoyl-1H-indazole-5-sulfonate is sourced from PubChem (CID 22567352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).