C14H17N3O2 — CID 22567449
(NE)-N-[[11-(dimethylamino)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-yl]methylidene]hydroxylamine (PubChem CID 22567449) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (NE)-N-[[11-(dimethylamino)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[11-(dimethylamino)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 22567449 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (NE)-N-[[11-(dimethylamino)-9-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-7-yl]methylidene]hydroxylamine |
| SMILES | CN(C)C1COc2c(/C=N/O)ccc3[nH]cc(c23)C1 |
| InChI | InChI=1S/C14H17N3O2/c1-17(2)11-5-10-6-15-12-4-3-9(7-16-18)14(13(10)12)19-8-11/h3-4,6-7,11,15,18H,5,8H2,1-2H3/b16-7+ |
| InChIKey | RJVBQMQKNMJOSA-FRKPEAEDSA-N |
| XLogP | 1.84 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|