C18H25BrF3NO3S — CID 22567686
N-[4-(3-bromopropoxymethyl)cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 22567686) has the molecular formula C18H25BrF3NO3S and a molecular weight of 472.37 g/mol. Its IUPAC name is N-[4-(3-bromopropoxymethyl)cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(3-bromopropoxymethyl)cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22567686 |
| Molecular Formula | C18H25BrF3NO3S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[4-(3-bromopropoxymethyl)cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C1CCC(COCCCBr)CC1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25BrF3NO3S/c1-23(16-7-3-14(4-8-16)13-26-12-2-11-19)27(24,25)17-9-5-15(6-10-17)18(20,21)22/h5-6,9-10,14,16H,2-4,7-8,11-13H2,1H3 |
| InChIKey | XOOBPYVDKGRWDP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|