C23H37F3N2O2S — CID 22567752
N-[4-[5-(diethylamino)pentyl]cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 22567752) has the molecular formula C23H37F3N2O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[4-[5-(diethylamino)pentyl]cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[5-(diethylamino)pentyl]cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22567752 |
| Molecular Formula | C23H37F3N2O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[4-[5-(diethylamino)pentyl]cyclohexyl]-N-methyl-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(CC)CCCCCC1CCC(N(C)S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H37F3N2O2S/c1-4-28(5-2)18-8-6-7-9-19-10-14-21(15-11-19)27(3)31(29,30)22-16-12-20(13-17-22)23(24,25)26/h12-13,16-17,19,21H,4-11,14-15,18H2,1-3H3 |
| InChIKey | NJPKKNHLXHTMLK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|