About 2-methylbuta-1,3-diene;penta-1,4-diene
2-methylbuta-1,3-diene;penta-1,4-diene (PubChem CID 22568286) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;penta-1,4-diene.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;penta-1,4-diene |
| PubChem CID | 22568286 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 2-methylbuta-1,3-diene;penta-1,4-diene |
| SMILES | C=CC(=C)C.C=CCC=C |
| InChI | InChI=1S/2C5H8/c1-4-5(2)3;1-3-5-4-2/h4H,1-2H2,3H3;3-4H,1-2,5H2 |
| InChIKey | JLBYLZXWMSADAP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;penta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;penta-1,4-diene?
The IUPAC name of 2-methylbuta-1,3-diene;penta-1,4-diene (CID 22568286) is 2-methylbuta-1,3-diene;penta-1,4-diene.
What is the SMILES notation for 2-methylbuta-1,3-diene;penta-1,4-diene?
The canonical SMILES for 2-methylbuta-1,3-diene;penta-1,4-diene is C=CC(=C)C.C=CCC=C.
What is the InChIKey of 2-methylbuta-1,3-diene;penta-1,4-diene?
The InChIKey is JLBYLZXWMSADAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8/c1-4-5(2)3;1-3-5-4-2/h4H,1-2H2,3H3;3-4H,1-2,5H2.
What are the key properties of 2-methylbuta-1,3-diene;penta-1,4-diene?
2-methylbuta-1,3-diene;penta-1,4-diene has a molecular weight of 136.24 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;penta-1,4-diene is sourced from PubChem (CID 22568286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).