About benzene-1,2-didiazonium
benzene-1,2-didiazonium (PubChem CID 22568635) has the molecular formula C6H4N4+2
and a molecular weight of 132.13 g/mol. Its IUPAC name is benzene-1,2-didiazonium.
Molecular Properties
| Compound Name | benzene-1,2-didiazonium |
| PubChem CID | 22568635 |
| Molecular Formula | C6H4N4+2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | benzene-1,2-didiazonium |
| SMILES | N#[N+]c1ccccc1[N+]#N |
| InChI | InChI=1S/C6H4N4/c7-9-5-3-1-2-4-6(5)10-8/h1-4H/q+2 |
| InChIKey | FKOLVOYBZCYQQJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-didiazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-didiazonium?
The IUPAC name of benzene-1,2-didiazonium (CID 22568635) is benzene-1,2-didiazonium.
What is the SMILES notation for benzene-1,2-didiazonium?
The canonical SMILES for benzene-1,2-didiazonium is N#[N+]c1ccccc1[N+]#N.
What is the InChIKey of benzene-1,2-didiazonium?
The InChIKey is FKOLVOYBZCYQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c7-9-5-3-1-2-4-6(5)10-8/h1-4H/q+2.
What are the key properties of benzene-1,2-didiazonium?
benzene-1,2-didiazonium has a molecular weight of 132.13 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-didiazonium is sourced from PubChem (CID 22568635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).