About 1-nitroethane;tetrachloromethane
1-nitroethane;tetrachloromethane (PubChem CID 22568660) has the molecular formula C3H5Cl4NO2
and a molecular weight of 228.89 g/mol. Its IUPAC name is 1-nitroethane;tetrachloromethane.
Molecular Properties
| Compound Name | 1-nitroethane;tetrachloromethane |
| PubChem CID | 22568660 |
| Molecular Formula | C3H5Cl4NO2 |
| Molecular Weight | 228.89 g/mol |
| Exact Mass | 226.91 |
| IUPAC Name | 1-nitroethane;tetrachloromethane |
| SMILES | CC[N+](=O)[O-].ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C2H5NO2.CCl4/c1-2-3(4)5;2-1(3,4)5/h2H2,1H3; |
| InChIKey | LQXUNQKPYSZPKT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.89 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroethane;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroethane;tetrachloromethane?
The IUPAC name of 1-nitroethane;tetrachloromethane (CID 22568660) is 1-nitroethane;tetrachloromethane.
What is the SMILES notation for 1-nitroethane;tetrachloromethane?
The canonical SMILES for 1-nitroethane;tetrachloromethane is CC[N+](=O)[O-].ClC(Cl)(Cl)Cl.
What is the InChIKey of 1-nitroethane;tetrachloromethane?
The InChIKey is LQXUNQKPYSZPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CCl4/c1-2-3(4)5;2-1(3,4)5/h2H2,1H3;.
What are the key properties of 1-nitroethane;tetrachloromethane?
1-nitroethane;tetrachloromethane has a molecular weight of 228.89 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroethane;tetrachloromethane is sourced from PubChem (CID 22568660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).