About 5-diazocyclohex-2-ene-1,4-dione
5-diazocyclohex-2-ene-1,4-dione (PubChem CID 22568770) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is 5-diazocyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5-diazocyclohex-2-ene-1,4-dione |
| PubChem CID | 22568770 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 5-diazocyclohex-2-ene-1,4-dione |
| SMILES | [N-]=[N+]=C1CC(=O)C=CC1=O |
| InChI | InChI=1S/C6H4N2O2/c7-8-5-3-4(9)1-2-6(5)10/h1-2H,3H2 |
| InChIKey | NDFPMZSLDATQFF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazocyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazocyclohex-2-ene-1,4-dione?
The IUPAC name of 5-diazocyclohex-2-ene-1,4-dione (CID 22568770) is 5-diazocyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5-diazocyclohex-2-ene-1,4-dione?
The canonical SMILES for 5-diazocyclohex-2-ene-1,4-dione is [N-]=[N+]=C1CC(=O)C=CC1=O.
What is the InChIKey of 5-diazocyclohex-2-ene-1,4-dione?
The InChIKey is NDFPMZSLDATQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c7-8-5-3-4(9)1-2-6(5)10/h1-2H,3H2.
What are the key properties of 5-diazocyclohex-2-ene-1,4-dione?
5-diazocyclohex-2-ene-1,4-dione has a molecular weight of 136.11 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazocyclohex-2-ene-1,4-dione is sourced from PubChem (CID 22568770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).