About 5,6-dihydro-1,3-benzodioxole
5,6-dihydro-1,3-benzodioxole (PubChem CID 22568775) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 5,6-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5,6-dihydro-1,3-benzodioxole |
| PubChem CID | 22568775 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 5,6-dihydro-1,3-benzodioxole |
| SMILES | C1=C2OCOC2=CCC1 |
| InChI | InChI=1S/C7H8O2/c1-2-4-7-6(3-1)8-5-9-7/h3-4H,1-2,5H2 |
| InChIKey | IHASFXKUPYNFSL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1,3-benzodioxole?
The IUPAC name of 5,6-dihydro-1,3-benzodioxole (CID 22568775) is 5,6-dihydro-1,3-benzodioxole.
What is the SMILES notation for 5,6-dihydro-1,3-benzodioxole?
The canonical SMILES for 5,6-dihydro-1,3-benzodioxole is C1=C2OCOC2=CCC1.
What is the InChIKey of 5,6-dihydro-1,3-benzodioxole?
The InChIKey is IHASFXKUPYNFSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-2-4-7-6(3-1)8-5-9-7/h3-4H,1-2,5H2.
What are the key properties of 5,6-dihydro-1,3-benzodioxole?
5,6-dihydro-1,3-benzodioxole has a molecular weight of 124.14 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1,3-benzodioxole is sourced from PubChem (CID 22568775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).