About (4-aminophenyl)methyl carbamate
(4-aminophenyl)methyl carbamate (PubChem CID 22569099) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is (4-aminophenyl)methyl carbamate.
Molecular Properties
| Compound Name | (4-aminophenyl)methyl carbamate |
| PubChem CID | 22569099 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (4-aminophenyl)methyl carbamate |
| SMILES | NC(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C8H10N2O2/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5,9H2,(H2,10,11) |
| InChIKey | BQQGAGGSEMLWRS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)methyl carbamate?
The IUPAC name of (4-aminophenyl)methyl carbamate (CID 22569099) is (4-aminophenyl)methyl carbamate.
What is the SMILES notation for (4-aminophenyl)methyl carbamate?
The canonical SMILES for (4-aminophenyl)methyl carbamate is NC(=O)OCc1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl)methyl carbamate?
The InChIKey is BQQGAGGSEMLWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c9-7-3-1-6(2-4-7)5-12-8(10)11/h1-4H,5,9H2,(H2,10,11).
What are the key properties of (4-aminophenyl)methyl carbamate?
(4-aminophenyl)methyl carbamate has a molecular weight of 166.18 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)methyl carbamate is sourced from PubChem (CID 22569099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).