C11H15NO5 — CID 22569239
2-acetyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3,3-dicarboxylic acid (PubChem CID 22569239) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-acetyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3,3-dicarboxylic acid.
| Compound Name | 2-acetyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22569239 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-acetyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3,3-dicarboxylic acid |
| SMILES | CC(=O)N1CC2CCCC2C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H15NO5/c1-6(13)12-5-7-3-2-4-8(7)11(12,9(14)15)10(16)17/h7-8H,2-5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VKXAGGKDPHMOEP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|