C30H30N2O4 — CID 2257137
(6R,6aS)-5-benzoyl-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-6,6a,8,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 2257137) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (6R,6aS)-5-benzoyl-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-6,6a,8,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aS)-5-benzoyl-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-6,6a,8,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2257137 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (6R,6aS)-5-benzoyl-6-(3,4-dimethoxyphenyl)-9,9-dimethyl-6,6a,8,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@H]2[C@@H]3C(=O)CC(C)(C)C=C3Nc3ccccc3N2C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H30N2O4/c1-30(2)17-22-27(24(33)18-30)28(20-14-15-25(35-3)26(16-20)36-4)32(23-13-9-8-12-21(23)31-22)29(34)19-10-6-5-7-11-19/h5-17,27-28,31H,18H2,1-4H3/t27-,28-/m0/s1 |
| InChIKey | BZXSCYHVSGNSEW-NSOVKSMOSA-N |
| XLogP | 6.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |