About 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine
1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine (PubChem CID 22572101) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine |
| PubChem CID | 22572101 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine |
| SMILES | CCCC1C(CC)=CC(CC)=CN1C1CCCCC1 |
| InChI | InChI=1S/C18H31N/c1-4-10-18-16(6-3)13-15(5-2)14-19(18)17-11-8-7-9-12-17/h13-14,17-18H,4-12H2,1-3H3 |
| InChIKey | KROCHRAIZPBMBP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine?
The IUPAC name of 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine (CID 22572101) is 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine.
What is the SMILES notation for 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine?
The canonical SMILES for 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine is CCCC1C(CC)=CC(CC)=CN1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine?
The InChIKey is KROCHRAIZPBMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-4-10-18-16(6-3)13-15(5-2)14-19(18)17-11-8-7-9-12-17/h13-14,17-18H,4-12H2,1-3H3.
What are the key properties of 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine?
1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine has a molecular weight of 261.45 g/mol, XLogP of 5.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,5-diethyl-2-propyl-2H-pyridine is sourced from PubChem (CID 22572101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).