About [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate
[4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate (PubChem CID 22572234) has the molecular formula C17H16F4O6S2
and a molecular weight of 456.44 g/mol. Its IUPAC name is [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate |
| PubChem CID | 22572234 |
| Molecular Formula | C17H16F4O6S2 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate |
| SMILES | CC(C)(c1cc(F)c(OS(C)(=O)=O)c(F)c1)c1cc(F)c(OS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C17H16F4O6S2/c1-17(2,9-5-11(18)15(12(19)6-9)26-28(3,22)23)10-7-13(20)16(14(21)8-10)27-29(4,24)25/h5-8H,1-4H3 |
| InChIKey | VOMLLQCELKTJCE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate?
The IUPAC name of [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate (CID 22572234) is [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate.
What is the SMILES notation for [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate?
The canonical SMILES for [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate is CC(C)(c1cc(F)c(OS(C)(=O)=O)c(F)c1)c1cc(F)c(OS(C)(=O)=O)c(F)c1.
What is the InChIKey of [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate?
The InChIKey is VOMLLQCELKTJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F4O6S2/c1-17(2,9-5-11(18)15(12(19)6-9)26-28(3,22)23)10-7-13(20)16(14(21)8-10)27-29(4,24)25/h5-8H,1-4H3.
What are the key properties of [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate?
[4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate has a molecular weight of 456.44 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(3,5-difluoro-4-methylsulfonyloxyphenyl)propan-2-yl]-2,6-difluorophenyl] methanesulfonate is sourced from PubChem (CID 22572234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).