C27H18F6O6S2 — CID 22572249
[4-[2-[4-(benzenesulfonyloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzenesulfonate (PubChem CID 22572249) has the molecular formula C27H18F6O6S2 and a molecular weight of 616.56 g/mol. Its IUPAC name is [4-[2-[4-(benzenesulfonyloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[2-[4-(benzenesulfonyloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 22572249 |
| Molecular Formula | C27H18F6O6S2 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.04 |
| IUPAC Name | [4-[2-[4-(benzenesulfonyloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C(c2ccc(OS(=O)(=O)c3ccccc3)cc2)(C(F)(F)F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H18F6O6S2/c28-26(29,30)25(27(31,32)33,19-11-15-21(16-12-19)38-40(34,35)23-7-3-1-4-8-23)20-13-17-22(18-14-20)39-41(36,37)24-9-5-2-6-10-24/h1-18H |
| InChIKey | BJPNDEXXHLVCKB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|