C31H24F6O6S2 — CID 22572348
[4-[9-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]fluoren-9-yl]-2,6-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 22572348) has the molecular formula C31H24F6O6S2 and a molecular weight of 670.65 g/mol. Its IUPAC name is [4-[9-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]fluoren-9-yl]-2,6-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[9-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]fluoren-9-yl]-2,6-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22572348 |
| Molecular Formula | C31H24F6O6S2 |
| Molecular Weight | 670.65 g/mol |
| Exact Mass | 670.09 |
| IUPAC Name | [4-[9-[3,5-dimethyl-4-(trifluoromethylsulfonyloxy)phenyl]fluoren-9-yl]-2,6-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C2(c3cc(C)c(OS(=O)(=O)C(F)(F)F)c(C)c3)c3ccccc3-c3ccccc32)cc(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C31H24F6O6S2/c1-17-13-21(14-18(2)27(17)42-44(38,39)30(32,33)34)29(25-11-7-5-9-23(25)24-10-6-8-12-26(24)29)22-15-19(3)28(20(4)16-22)43-45(40,41)31(35,36)37/h5-16H,1-4H3 |
| InChIKey | WTIHRLYPWISVHQ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.65 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|