About 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol
3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol (PubChem CID 22572360) has the molecular formula C9H20O4S4
and a molecular weight of 320.52 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol |
| PubChem CID | 22572360 |
| Molecular Formula | C9H20O4S4 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol |
| SMILES | OCC(O)CSSCCCSSCC(O)CO |
| InChI | InChI=1S/C9H20O4S4/c10-4-8(12)6-16-14-2-1-3-15-17-7-9(13)5-11/h8-13H,1-7H2 |
| InChIKey | SHIMTELHPVIVTG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol?
The IUPAC name of 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol (CID 22572360) is 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol.
What is the SMILES notation for 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol?
The canonical SMILES for 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol is OCC(O)CSSCCCSSCC(O)CO.
What is the InChIKey of 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol?
The InChIKey is SHIMTELHPVIVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4S4/c10-4-8(12)6-16-14-2-1-3-15-17-7-9(13)5-11/h8-13H,1-7H2.
What are the key properties of 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol?
3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol has a molecular weight of 320.52 g/mol, XLogP of 0.85, 12 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,3-dihydroxypropyldisulfanyl)propyldisulfanyl]propane-1,2-diol is sourced from PubChem (CID 22572360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).