C25H27F3N2O2 — CID 22573220
(6Z)-4-(1-phenyl-2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-5,8-dihydro-1,4-oxazocin-3-one (PubChem CID 22573220) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is (6Z)-4-(1-phenyl-2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-5,8-dihydro-1,4-oxazocin-3-one.
| Compound Name | (6Z)-4-(1-phenyl-2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-5,8-dihydro-1,4-oxazocin-3-one |
|---|---|
| PubChem CID | 22573220 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (6Z)-4-(1-phenyl-2-pyrrolidin-1-ylethyl)-2-[4-(trifluoromethyl)phenyl]-5,8-dihydro-1,4-oxazocin-3-one |
| SMILES | O=C1C(c2ccc(C(F)(F)F)cc2)OC/C=C\CN1C(CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H27F3N2O2/c26-25(27,28)21-12-10-20(11-13-21)23-24(31)30(16-6-7-17-32-23)22(18-29-14-4-5-15-29)19-8-2-1-3-9-19/h1-3,6-13,22-23H,4-5,14-18H2/b7-6- |
| InChIKey | AWHWBPFITMFIJK-SREVYHEPSA-N |
| XLogP | 5.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|