C20H22N2O2S — CID 22573263
N-(2-azabicyclo[2.2.1]heptan-6-yl)-4-(2-methoxyphenyl)sulfanylbenzamide (PubChem CID 22573263) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(2-azabicyclo[2.2.1]heptan-6-yl)-4-(2-methoxyphenyl)sulfanylbenzamide.
| Compound Name | N-(2-azabicyclo[2.2.1]heptan-6-yl)-4-(2-methoxyphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 22573263 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(2-azabicyclo[2.2.1]heptan-6-yl)-4-(2-methoxyphenyl)sulfanylbenzamide |
| SMILES | COc1ccccc1Sc1ccc(C(=O)NC2CC3CNC2C3)cc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-24-18-4-2-3-5-19(18)25-15-8-6-14(7-9-15)20(23)22-17-11-13-10-16(17)21-12-13/h2-9,13,16-17,21H,10-12H2,1H3,(H,22,23) |
| InChIKey | JBNMDKNLPOSKSW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |