C18H23N3OS2 — CID 22573639
N-(1-azabicyclo[3.2.2]nonan-3-yl)-4-(3H-1,2-thiazol-2-ylsulfanyl)benzamide (PubChem CID 22573639) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is N-(1-azabicyclo[3.2.2]nonan-3-yl)-4-(3H-1,2-thiazol-2-ylsulfanyl)benzamide.
| Compound Name | N-(1-azabicyclo[3.2.2]nonan-3-yl)-4-(3H-1,2-thiazol-2-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 22573639 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-(1-azabicyclo[3.2.2]nonan-3-yl)-4-(3H-1,2-thiazol-2-ylsulfanyl)benzamide |
| SMILES | O=C(NC1CC2CCN(CC2)C1)c1ccc(SN2CC=CS2)cc1 |
| InChI | InChI=1S/C18H23N3OS2/c22-18(19-16-12-14-6-9-20(13-16)10-7-14)15-2-4-17(5-3-15)24-21-8-1-11-23-21/h1-5,11,14,16H,6-10,12-13H2,(H,19,22) |
| InChIKey | GAVLXIJNWPUYLC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|