About 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane
2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 22573910) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 22573910 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | c1ncc(N2CC3CC2CN3)cn1 |
| InChI | InChI=1S/C9H12N4/c1-7-5-13(8(1)4-12-7)9-2-10-6-11-3-9/h2-3,6-8,12H,1,4-5H2 |
| InChIKey | XWJMSESMIIBXEB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane (CID 22573910) is 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane is c1ncc(N2CC3CC2CN3)cn1.
What is the InChIKey of 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is XWJMSESMIIBXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-7-5-13(8(1)4-12-7)9-2-10-6-11-3-9/h2-3,6-8,12H,1,4-5H2.
What are the key properties of 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane?
2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 176.22 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-5-yl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 22573910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).