C17H13BrN4OS — CID 2257415
(4Z)-10-bromo-4-[[4-(dimethylamino)phenyl]methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one (PubChem CID 2257415) has the molecular formula C17H13BrN4OS and a molecular weight of 401.29 g/mol. Its IUPAC name is (4Z)-10-bromo-4-[[4-(dimethylamino)phenyl]methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one.
| Compound Name | (4Z)-10-bromo-4-[[4-(dimethylamino)phenyl]methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 2257415 |
| Molecular Formula | C17H13BrN4OS |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | (4Z)-10-bromo-4-[[4-(dimethylamino)phenyl]methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
| SMILES | CN(C)c1ccc(/C=c2\sc3nc4cc(Br)cnc4n3c2=O)cc1 |
| InChI | InChI=1S/C17H13BrN4OS/c1-21(2)12-5-3-10(4-6-12)7-14-16(23)22-15-13(20-17(22)24-14)8-11(18)9-19-15/h3-9H,1-2H3/b14-7- |
| InChIKey | RVVNRNNKMZEVPH-AUWJEWJLSA-N |
| XLogP | 2.68 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|