C17H14ClN5O2S — CID 22574304
3-(azidomethyl)-N-[(4-chlorophenyl)methyl]-4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide (PubChem CID 22574304) has the molecular formula C17H14ClN5O2S and a molecular weight of 387.85 g/mol. Its IUPAC name is 3-(azidomethyl)-N-[(4-chlorophenyl)methyl]-4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide.
| Compound Name | 3-(azidomethyl)-N-[(4-chlorophenyl)methyl]-4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 22574304 |
| Molecular Formula | C17H14ClN5O2S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-(azidomethyl)-N-[(4-chlorophenyl)methyl]-4-methyl-7-oxothieno[3,2-b]pyridine-6-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2scc(CN=[N+]=[N-])c21 |
| InChI | InChI=1S/C17H14ClN5O2S/c1-23-8-13(17(25)20-6-10-2-4-12(18)5-3-10)15(24)16-14(23)11(9-26-16)7-21-22-19/h2-5,8-9H,6-7H2,1H3,(H,20,25) |
| InChIKey | KZRXZSZRZFRWJH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|