C25H28F6N2O6S2 — CID 22574476
[4-[[benzyl-[[3,5-bis(trifluoromethyl)benzoyl]sulfamoyl]amino]methyl]cyclohexyl]methyl methanesulfonate (PubChem CID 22574476) has the molecular formula C25H28F6N2O6S2 and a molecular weight of 630.63 g/mol. Its IUPAC name is [4-[[benzyl-[[3,5-bis(trifluoromethyl)benzoyl]sulfamoyl]amino]methyl]cyclohexyl]methyl methanesulfonate.
| Compound Name | [4-[[benzyl-[[3,5-bis(trifluoromethyl)benzoyl]sulfamoyl]amino]methyl]cyclohexyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 22574476 |
| Molecular Formula | C25H28F6N2O6S2 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | [4-[[benzyl-[[3,5-bis(trifluoromethyl)benzoyl]sulfamoyl]amino]methyl]cyclohexyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CCC(CN(Cc2ccccc2)S(=O)(=O)NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H28F6N2O6S2/c1-40(35,36)39-16-19-9-7-18(8-10-19)15-33(14-17-5-3-2-4-6-17)41(37,38)32-23(34)20-11-21(24(26,27)28)13-22(12-20)25(29,30)31/h2-6,11-13,18-19H,7-10,14-16H2,1H3,(H,32,34) |
| InChIKey | GSBWFMWXFNYODS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|