C26H34N2O6S — CID 22574931
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(hydroxymethyl)-2-(2-methylpropyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide (PubChem CID 22574931) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(hydroxymethyl)-2-(2-methylpropyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(hydroxymethyl)-2-(2-methylpropyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22574931 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(hydroxymethyl)-2-(2-methylpropyl)phenyl]-N-(2-methoxyethoxymethyl)benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(CO)cc1CC(C)C |
| InChI | InChI=1S/C26H34N2O6S/c1-18(2)14-22-15-21(16-29)10-11-23(22)24-8-6-7-9-25(24)35(30,31)28(17-33-13-12-32-5)26-19(3)20(4)27-34-26/h6-11,15,18,29H,12-14,16-17H2,1-5H3 |
| InChIKey | WPBKPOJETPRIKR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|