C30H42N2O7SSi — CID 22575000
methyl 4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-[(2-methylpropan-2-yl)oxymethyl]benzoate (PubChem CID 22575000) has the molecular formula C30H42N2O7SSi and a molecular weight of 602.83 g/mol. Its IUPAC name is methyl 4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-[(2-methylpropan-2-yl)oxymethyl]benzoate.
| Compound Name | methyl 4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-[(2-methylpropan-2-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 22575000 |
| Molecular Formula | C30H42N2O7SSi |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | methyl 4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-[(2-methylpropan-2-yl)oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccccc2S(=O)(=O)N(COCC[Si](C)(C)C)c2onc(C)c2C)c(COC(C)(C)C)c1 |
| InChI | InChI=1S/C30H42N2O7SSi/c1-21-22(2)31-39-28(21)32(20-37-16-17-41(7,8)9)40(34,35)27-13-11-10-12-26(27)25-15-14-23(29(33)36-6)18-24(25)19-38-30(3,4)5/h10-15,18H,16-17,19-20H2,1-9H3 |
| InChIKey | YVFXGOHOUDYBEP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|