C23H23N3O2S2 — CID 22575296
N-[2-(4-methylsulfanylphenyl)ethyl]-2-(9-oxo-7-thia-2,10-diazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaen-10-yl)acetamide (PubChem CID 22575296) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-[2-(4-methylsulfanylphenyl)ethyl]-2-(9-oxo-7-thia-2,10-diazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaen-10-yl)acetamide.
| Compound Name | N-[2-(4-methylsulfanylphenyl)ethyl]-2-(9-oxo-7-thia-2,10-diazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaen-10-yl)acetamide |
|---|---|
| PubChem CID | 22575296 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[2-(4-methylsulfanylphenyl)ethyl]-2-(9-oxo-7-thia-2,10-diazatricyclo[9.4.0.02,6]pentadeca-1(15),3,5,11,13-pentaen-10-yl)acetamide |
| SMILES | CSc1ccc(CCNC(=O)CN2C(=O)CSc3cccn3-c3ccccc32)cc1 |
| InChI | InChI=1S/C23H23N3O2S2/c1-29-18-10-8-17(9-11-18)12-13-24-21(27)15-26-20-6-3-2-5-19(20)25-14-4-7-23(25)30-16-22(26)28/h2-11,14H,12-13,15-16H2,1H3,(H,24,27) |
| InChIKey | ZNUOEKUSOQCGOW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |