C26H25NO5S — CID 22575392
2-ethoxyethyl 5-[(3-methoxyphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxylate (PubChem CID 22575392) has the molecular formula C26H25NO5S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-ethoxyethyl 5-[(3-methoxyphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxylate.
| Compound Name | 2-ethoxyethyl 5-[(3-methoxyphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxylate |
|---|---|
| PubChem CID | 22575392 |
| Molecular Formula | C26H25NO5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-ethoxyethyl 5-[(3-methoxyphenyl)methyl]-6-oxobenzo[b][1,4]benzothiazepine-3-carboxylate |
| SMILES | CCOCCOC(=O)c1ccc2c(c1)N(Cc1cccc(OC)c1)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C26H25NO5S/c1-3-31-13-14-32-26(29)19-11-12-24-22(16-19)27(17-18-7-6-8-20(15-18)30-2)25(28)21-9-4-5-10-23(21)33-24/h4-12,15-16H,3,13-14,17H2,1-2H3 |
| InChIKey | GGMQXZSEPOVVJO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|