C17H15ClN6O2 — CID 22577200
1-[5-(4-chlorophenyl)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 22577200) has the molecular formula C17H15ClN6O2 and a molecular weight of 370.80 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[5-(4-chlorophenyl)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 22577200 |
| Molecular Formula | C17H15ClN6O2 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccc(Cl)cc2)OC1c1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C17H15ClN6O2/c1-9-8-10(2)23-17(19-9)20-14(21-23)16-24(11(3)25)22-15(26-16)12-4-6-13(18)7-5-12/h4-8,16H,1-3H3 |
| InChIKey | WMJNTSBZAMBRIF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |