C24H17Cl2N3O3 — CID 22577234
10-[[3-acetyl-5-(3,4-dichlorophenyl)-2H-1,3,4-oxadiazol-2-yl]methyl]acridin-9-one (PubChem CID 22577234) has the molecular formula C24H17Cl2N3O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is 10-[[3-acetyl-5-(3,4-dichlorophenyl)-2H-1,3,4-oxadiazol-2-yl]methyl]acridin-9-one.
| Compound Name | 10-[[3-acetyl-5-(3,4-dichlorophenyl)-2H-1,3,4-oxadiazol-2-yl]methyl]acridin-9-one |
|---|---|
| PubChem CID | 22577234 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 10-[[3-acetyl-5-(3,4-dichlorophenyl)-2H-1,3,4-oxadiazol-2-yl]methyl]acridin-9-one |
| SMILES | CC(=O)N1N=C(c2ccc(Cl)c(Cl)c2)OC1Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H17Cl2N3O3/c1-14(30)29-22(32-24(27-29)15-10-11-18(25)19(26)12-15)13-28-20-8-4-2-6-16(20)23(31)17-7-3-5-9-21(17)28/h2-12,22H,13H2,1H3 |
| InChIKey | QHYGOQHFIKDRJH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|