C15H13N7OS — CID 22577376
5-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 22577376) has the molecular formula C15H13N7OS and a molecular weight of 339.38 g/mol. Its IUPAC name is 5-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 22577376 |
| Molecular Formula | C15H13N7OS |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 5-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cccc(-c2nc(SCc3cc(=O)n4[nH]cnc4n3)n[nH]2)c1 |
| InChI | InChI=1S/C15H13N7OS/c1-9-3-2-4-10(5-9)13-19-15(21-20-13)24-7-11-6-12(23)22-14(18-11)16-8-17-22/h2-6,8H,7H2,1H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | YVDJQDGBNFBPBP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |