C19H30N4OS — CID 22577641
2-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide (PubChem CID 22577641) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 22577641 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
| SMILES | CC1CN(CC(=O)NCCCN2CCN(C)CC2)c2ccccc2S1 |
| InChI | InChI=1S/C19H30N4OS/c1-16-14-23(17-6-3-4-7-18(17)25-16)15-19(24)20-8-5-9-22-12-10-21(2)11-13-22/h3-4,6-7,16H,5,8-15H2,1-2H3,(H,20,24) |
| InChIKey | FIEOZLOTPQUNQI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|