C25H26FN3OS — CID 22579101
N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(4-fluorophenyl)-3H-1,5-benzodiazepin-4-yl]sulfanyl]acetamide (PubChem CID 22579101) has the molecular formula C25H26FN3OS and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(4-fluorophenyl)-3H-1,5-benzodiazepin-4-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(4-fluorophenyl)-3H-1,5-benzodiazepin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 22579101 |
| Molecular Formula | C25H26FN3OS |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(4-fluorophenyl)-3H-1,5-benzodiazepin-4-yl]sulfanyl]acetamide |
| SMILES | O=C(CSC1=Nc2ccccc2N=C(c2ccc(F)cc2)C1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C25H26FN3OS/c26-20-12-10-19(11-13-20)23-16-25(29-22-9-5-4-8-21(22)28-23)31-17-24(30)27-15-14-18-6-2-1-3-7-18/h4-6,8-13H,1-3,7,14-17H2,(H,27,30) |
| InChIKey | XRWWOZJCWYTEFD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|