About N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide
N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 2258010) has the molecular formula C17H25N3O3
and a molecular weight of 319.40 g/mol. Its IUPAC name is N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide.
Molecular Properties
| Compound Name | N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
| PubChem CID | 2258010 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-13-10-14(2)12-15(11-13)19-17(22)16(21)18-4-3-5-20-6-8-23-9-7-20/h10-12H,3-9H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | LMWIRTLSASNTCT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide?
The IUPAC name of N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide (CID 2258010) is N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide.
What is the SMILES notation for N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide?
The canonical SMILES for N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide is Cc1cc(C)cc(NC(=O)C(=O)NCCCN2CCOCC2)c1.
What is the InChIKey of N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide?
The InChIKey is LMWIRTLSASNTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O3/c1-13-10-14(2)12-15(11-13)19-17(22)16(21)18-4-3-5-20-6-8-23-9-7-20/h10-12H,3-9H2,1-2H3,(H,18,21)(H,19,22).
What are the key properties of N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide?
N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide has a molecular weight of 319.40 g/mol, XLogP of 1.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dimethylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide is sourced from PubChem (CID 2258010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).