C20H21N3O3 — CID 22580423
N-[2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]pentanamide (PubChem CID 22580423) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]pentanamide.
| Compound Name | N-[2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]pentanamide |
|---|---|
| PubChem CID | 22580423 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccccc1OCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C20H21N3O3/c1-2-3-11-19(24)22-16-8-4-5-9-17(16)26-14-15-13-20(25)23-12-7-6-10-18(23)21-15/h4-10,12-13H,2-3,11,14H2,1H3,(H,22,24) |
| InChIKey | GQPKUKHIHWFSRY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |