C17H20N2S — CID 2258183
5-phenylspiro[3H-1,3,4-thiadiazole-2,2'-adamantane] (PubChem CID 2258183) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 5-phenylspiro[3H-1,3,4-thiadiazole-2,2'-adamantane].
| Compound Name | 5-phenylspiro[3H-1,3,4-thiadiazole-2,2'-adamantane] |
|---|---|
| PubChem CID | 2258183 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-phenylspiro[3H-1,3,4-thiadiazole-2,2'-adamantane] |
| SMILES | c1ccc(C2=NNC3(S2)C2CC4CC(C2)CC3C4)cc1 |
| InChI | InChI=1S/C17H20N2S/c1-2-4-13(5-3-1)16-18-19-17(20-16)14-7-11-6-12(9-14)10-15(17)8-11/h1-5,11-12,14-15,19H,6-10H2 |
| InChIKey | SUBSLBGGPRTQTR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |