C17H15N3O6S2 — CID 22583251
N-(3-methoxyphenyl)-5-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophene-2-sulfonamide (PubChem CID 22583251) has the molecular formula C17H15N3O6S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophene-2-sulfonamide.
| Compound Name | N-(3-methoxyphenyl)-5-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22583251 |
| Molecular Formula | C17H15N3O6S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-(3-methoxyphenyl)-5-[(E)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc(/C=C/c3onc(C)c3[N+](=O)[O-])s2)c1 |
| InChI | InChI=1S/C17H15N3O6S2/c1-11-17(20(21)22)15(26-18-11)8-6-14-7-9-16(27-14)28(23,24)19-12-4-3-5-13(10-12)25-2/h3-10,19H,1-2H3/b8-6+ |
| InChIKey | MFEZAFSQMLUYBP-SOFGYWHQSA-N |
| XLogP | 3.93 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|