About 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid
2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 22583823) has the molecular formula C19H22N2O3S
and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 22583823 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H22N2O3S/c22-17(15-8-4-5-9-16(15)19(23)24)20-11-10-14-12-25-18(21-14)13-6-2-1-3-7-13/h1-3,6-7,12,15-16H,4-5,8-11H2,(H,20,22)(H,23,24) |
| InChIKey | YIZWACHEPUOPQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid (CID 22583823) is 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCCCC1C(=O)NCCc1csc(-c2ccccc2)n1.
What is the InChIKey of 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is YIZWACHEPUOPQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3S/c22-17(15-8-4-5-9-16(15)19(23)24)20-11-10-14-12-25-18(21-14)13-6-2-1-3-7-13/h1-3,6-7,12,15-16H,4-5,8-11H2,(H,20,22)(H,23,24).
What are the key properties of 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid?
2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 358.46 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 22583823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).