C19H15F2NO3S2 — CID 22584082
4-fluoro-N-[2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]benzamide (PubChem CID 22584082) has the molecular formula C19H15F2NO3S2 and a molecular weight of 407.46 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 22584082 |
| Molecular Formula | C19H15F2NO3S2 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 4-fluoro-N-[2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(NCC(c1cccs1)S(=O)(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F2NO3S2/c20-14-5-3-13(4-6-14)19(23)22-12-18(17-2-1-11-26-17)27(24,25)16-9-7-15(21)8-10-16/h1-11,18H,12H2,(H,22,23) |
| InChIKey | NTIQBFDJXWEMIE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |