C15H7BrClN3OS — CID 2258411
(4Z)-10-bromo-4-[(2-chlorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one (PubChem CID 2258411) has the molecular formula C15H7BrClN3OS and a molecular weight of 392.67 g/mol. Its IUPAC name is (4Z)-10-bromo-4-[(2-chlorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one.
| Compound Name | (4Z)-10-bromo-4-[(2-chlorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 2258411 |
| Molecular Formula | C15H7BrClN3OS |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | (4Z)-10-bromo-4-[(2-chlorophenyl)methylidene]-5-thia-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
| SMILES | O=c1/c(=C/c2ccccc2Cl)sc2nc3cc(Br)cnc3n12 |
| InChI | InChI=1S/C15H7BrClN3OS/c16-9-6-11-13(18-7-9)20-14(21)12(22-15(20)19-11)5-8-3-1-2-4-10(8)17/h1-7H/b12-5- |
| InChIKey | VCMZPVCCQDEZRB-XGICHPGQSA-N |
| XLogP | 3.27 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |