C24H29N3O5S — CID 22584277
N-(2,5-dimethylphenyl)-2-[4-(4-methylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-2-oxoacetamide (PubChem CID 22584277) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[4-(4-methylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-2-oxoacetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[4-(4-methylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 22584277 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[4-(4-methylphenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC23CCN(C(=O)C(=O)Nc2cc(C)ccc2C)CC3)cc1 |
| InChI | InChI=1S/C24H29N3O5S/c1-17-5-8-20(9-6-17)33(30,31)27-14-15-32-24(27)10-12-26(13-11-24)23(29)22(28)25-21-16-18(2)4-7-19(21)3/h4-9,16H,10-15H2,1-3H3,(H,25,28) |
| InChIKey | CRECNBBLADSOLO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|