C24H22FN3O5S — CID 22584616
N'-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 22584616) has the molecular formula C24H22FN3O5S and a molecular weight of 483.52 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 22584616 |
| Molecular Formula | C24H22FN3O5S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N'-[2-(4-fluorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC(c1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN3O5S/c25-17-7-9-18(10-8-17)34(31,32)22(21-6-3-13-33-21)15-28-24(30)23(29)26-12-11-16-14-27-20-5-2-1-4-19(16)20/h1-10,13-14,22,27H,11-12,15H2,(H,26,29)(H,28,30) |
| InChIKey | UKXUJDLGIHDLOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|