C16H20N4O3S — CID 22585089
2-[[5-methoxy-2-(pyrimidin-2-ylsulfanylmethyl)-4-pyridinyl]oxy]-N-propan-2-ylacetamide (PubChem CID 22585089) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[[5-methoxy-2-(pyrimidin-2-ylsulfanylmethyl)-4-pyridinyl]oxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[[5-methoxy-2-(pyrimidin-2-ylsulfanylmethyl)-4-pyridinyl]oxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 22585089 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[[5-methoxy-2-(pyrimidin-2-ylsulfanylmethyl)-4-pyridinyl]oxy]-N-propan-2-ylacetamide |
| SMILES | COc1cnc(CSc2ncccn2)cc1OCC(=O)NC(C)C |
| InChI | InChI=1S/C16H20N4O3S/c1-11(2)20-15(21)9-23-13-7-12(19-8-14(13)22-3)10-24-16-17-5-4-6-18-16/h4-8,11H,9-10H2,1-3H3,(H,20,21) |
| InChIKey | YSGWBFQRDCQCQJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |