C18H22BrN5O — CID 22585317
(3-bromophenyl)-[4-[4-(dimethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 22585317) has the molecular formula C18H22BrN5O and a molecular weight of 404.31 g/mol. Its IUPAC name is (3-bromophenyl)-[4-[4-(dimethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-[4-(dimethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22585317 |
| Molecular Formula | C18H22BrN5O |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (3-bromophenyl)-[4-[4-(dimethylamino)-6-methylpyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(N(C)C)nc(N2CCN(C(=O)c3cccc(Br)c3)CC2)n1 |
| InChI | InChI=1S/C18H22BrN5O/c1-13-11-16(22(2)3)21-18(20-13)24-9-7-23(8-10-24)17(25)14-5-4-6-15(19)12-14/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | SZESQVIONBOJDZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |