C18H19ClF3N3OS — CID 22585470
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(1-cyclohexylimidazol-2-yl)sulfanylacetamide (PubChem CID 22585470) has the molecular formula C18H19ClF3N3OS and a molecular weight of 417.88 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(1-cyclohexylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(1-cyclohexylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 22585470 |
| Molecular Formula | C18H19ClF3N3OS |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(1-cyclohexylimidazol-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nccn1C1CCCCC1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H19ClF3N3OS/c19-14-7-6-12(18(20,21)22)10-15(14)24-16(26)11-27-17-23-8-9-25(17)13-4-2-1-3-5-13/h6-10,13H,1-5,11H2,(H,24,26) |
| InChIKey | FPFAEQTZXQEGMQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |