C20H14N4O3S — CID 22588383
3-[3-(3-methoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one (PubChem CID 22588383) has the molecular formula C20H14N4O3S and a molecular weight of 390.42 g/mol. Its IUPAC name is 3-[3-(3-methoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one.
| Compound Name | 3-[3-(3-methoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
|---|---|
| PubChem CID | 22588383 |
| Molecular Formula | C20H14N4O3S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-[3-(3-methoxyphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
| SMILES | COc1cccc(-c2nnc3n2N=C(c2cc4ccccc4oc2=O)CS3)c1 |
| InChI | InChI=1S/C20H14N4O3S/c1-26-14-7-4-6-13(9-14)18-21-22-20-24(18)23-16(11-28-20)15-10-12-5-2-3-8-17(12)27-19(15)25/h2-10H,11H2,1H3 |
| InChIKey | CSENXMUVKZZOAB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|