C25H25N3O3S2 — CID 22589283
2-[(4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide (PubChem CID 22589283) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[(4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 22589283 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[(4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl)sulfanyl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CSC1=NS(=O)(=O)c2ccccc2N1Cc1ccccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C25H25N3O3S2/c29-24(26-17-9-14-20-10-3-1-4-11-20)19-32-25-27-33(30,31)23-16-8-7-15-22(23)28(25)18-21-12-5-2-6-13-21/h1-8,10-13,15-16H,9,14,17-19H2,(H,26,29) |
| InChIKey | IMTVLKKHOKEUKL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|