C30H39N3O3S — CID 22589599
6-[2-[(4-tert-butylphenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]-N-(oxolan-2-ylmethyl)hexanamide (PubChem CID 22589599) has the molecular formula C30H39N3O3S and a molecular weight of 521.73 g/mol. Its IUPAC name is 6-[2-[(4-tert-butylphenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]-N-(oxolan-2-ylmethyl)hexanamide.
| Compound Name | 6-[2-[(4-tert-butylphenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]-N-(oxolan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 22589599 |
| Molecular Formula | C30H39N3O3S |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 6-[2-[(4-tert-butylphenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]-N-(oxolan-2-ylmethyl)hexanamide |
| SMILES | CC(C)(C)c1ccc(CSc2nc3ccccc3c(=O)n2CCCCCC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C30H39N3O3S/c1-30(2,3)23-16-14-22(15-17-23)21-37-29-32-26-12-7-6-11-25(26)28(35)33(29)18-8-4-5-13-27(34)31-20-24-10-9-19-36-24/h6-7,11-12,14-17,24H,4-5,8-10,13,18-21H2,1-3H3,(H,31,34) |
| InChIKey | AAXIPAKAJLFYMG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|