C21H17N3O3S3 — CID 22589823
2-[[3-(4-ethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetic acid (PubChem CID 22589823) has the molecular formula C21H17N3O3S3 and a molecular weight of 455.59 g/mol. Its IUPAC name is 2-[[3-(4-ethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[3-(4-ethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 22589823 |
| Molecular Formula | C21H17N3O3S3 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 2-[[3-(4-ethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetic acid |
| SMILES | CCc1ccc(-n2c(=S)sc3c(=O)n(-c4ccccc4)c(SCC(=O)O)nc32)cc1 |
| InChI | InChI=1S/C21H17N3O3S3/c1-2-13-8-10-15(11-9-13)23-18-17(30-21(23)28)19(27)24(14-6-4-3-5-7-14)20(22-18)29-12-16(25)26/h3-11H,2,12H2,1H3,(H,25,26) |
| InChIKey | YUUBPKKFZCGTOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|